C22H38N4O4S3 — CID 156598803
N-[2-[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethyl]-5-[(3R)-dithiolan-3-yl]pentanamide (PubChem CID 156598803) has the molecular formula C22H38N4O4S3 and a molecular weight of 518.77 g/mol. Its IUPAC name is N-[2-[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethyl]-5-[(3R)-dithiolan-3-yl]pentanamide.
| Compound Name | N-[2-[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethyl]-5-[(3R)-dithiolan-3-yl]pentanamide |
|---|---|
| PubChem CID | 156598803 |
| Molecular Formula | C22H38N4O4S3 |
| Molecular Weight | 518.77 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | N-[2-[2-[5-[(3aR,4R,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethyl]-5-[(3R)-dithiolan-3-yl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1CCSS1)NCCOCCNC(=O)CCCC[C@H]1SC[C@H]2NC(=O)N[C@H]21 |
| InChI | InChI=1S/C22H38N4O4S3/c27-19(7-3-1-5-16-9-14-32-33-16)23-10-12-30-13-11-24-20(28)8-4-2-6-18-21-17(15-31-18)25-22(29)26-21/h16-18,21H,1-15H2,(H,23,27)(H,24,28)(H2,25,26,29)/t16-,17-,18-,21-/m1/s1 |
| InChIKey | LJZDYVXPZRTHDQ-NEYJZJCJSA-N |
| XLogP | 2.68 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|