C13H9F11O2 — CID 156598959
1,1,1,3,3-pentafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butan-2-ol (PubChem CID 156598959) has the molecular formula C13H9F11O2 and a molecular weight of 406.19 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butan-2-ol.
| Compound Name | 1,1,1,3,3-pentafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 156598959 |
| Molecular Formula | C13H9F11O2 |
| Molecular Weight | 406.19 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]butan-2-ol |
| SMILES | CC(F)(F)C(O)(c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H9F11O2/c1-8(14,15)9(25,11(16,17)18)6-2-4-7(5-3-6)10(26,12(19,20)21)13(22,23)24/h2-5,25-26H,1H3 |
| InChIKey | GPXRDAQTFCJLLU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.19 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |