About [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate
[(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate (PubChem CID 156599308) has the molecular formula C16H20N6O2
and a molecular weight of 328.38 g/mol. Its IUPAC name is [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate |
| PubChem CID | 156599308 |
| Molecular Formula | C16H20N6O2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H](Cc1cn(Cc2ccccc2)nn1)N=[N+]=[N-] |
| InChI | InChI=1S/C16H20N6O2/c1-12(2)16(23)24-11-15(18-20-17)8-14-10-22(21-19-14)9-13-6-4-3-5-7-13/h3-7,10,12,15H,8-9,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | OSSIEQGURGVHAD-HNNXBMFYSA-N |
| XLogP | 2.75 |
| TPSA | 105.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate?
The IUPAC name of [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate (CID 156599308) is [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate.
What is the SMILES notation for [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate?
The canonical SMILES for [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate is CC(C)C(=O)OC[C@H](Cc1cn(Cc2ccccc2)nn1)N=[N+]=[N-].
What is the InChIKey of [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate?
The InChIKey is OSSIEQGURGVHAD-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H20N6O2/c1-12(2)16(23)24-11-15(18-20-17)8-14-10-22(21-19-14)9-13-6-4-3-5-7-13/h3-7,10,12,15H,8-9,11H2,1-2H3/t15-/m0/s1.
What are the key properties of [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate?
[(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate has a molecular weight of 328.38 g/mol, XLogP of 2.75, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-azido-3-(1-benzyltriazol-4-yl)propyl] 2-methylpropanoate is sourced from PubChem (CID 156599308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).