C16H22FNO5 — CID 156599511
methyl 3-(2-fluoro-5-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 156599511) has the molecular formula C16H22FNO5 and a molecular weight of 327.35 g/mol. Its IUPAC name is methyl 3-(2-fluoro-5-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl 3-(2-fluoro-5-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 156599511 |
| Molecular Formula | C16H22FNO5 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | methyl 3-(2-fluoro-5-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(Cc1cc(OC)ccc1F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22FNO5/c1-16(2,3)23-15(20)18-13(14(19)22-5)9-10-8-11(21-4)6-7-12(10)17/h6-8,13H,9H2,1-5H3,(H,18,20) |
| InChIKey | ZFKBFWGUGBDBOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |