C11H13F13N3S+ — CID 156600012
pentafluoro-[1,1,2,2,3,3,4,4-octafluoro-6-(1-propyl-1,2,4-triazol-4-ium-4-yl)hexyl]-λ6-sulfane (PubChem CID 156600012) has the molecular formula C11H13F13N3S+ and a molecular weight of 466.29 g/mol. Its IUPAC name is pentafluoro-[1,1,2,2,3,3,4,4-octafluoro-6-(1-propyl-1,2,4-triazol-4-ium-4-yl)hexyl]-λ6-sulfane.
| Compound Name | pentafluoro-[1,1,2,2,3,3,4,4-octafluoro-6-(1-propyl-1,2,4-triazol-4-ium-4-yl)hexyl]-λ6-sulfane |
|---|---|
| PubChem CID | 156600012 |
| Molecular Formula | C11H13F13N3S+ |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | pentafluoro-[1,1,2,2,3,3,4,4-octafluoro-6-(1-propyl-1,2,4-triazol-4-ium-4-yl)hexyl]-λ6-sulfane |
| SMILES | CCCn1c[n+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(F)(F)(F)(F)F)cn1 |
| InChI | InChI=1S/C11H13F13N3S/c1-2-4-27-7-26(6-25-27)5-3-8(12,13)9(14,15)10(16,17)11(18,19)28(20,21,22,23)24/h6-7H,2-5H2,1H3/q+1 |
| InChIKey | DQNHBUABUFMNIQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|