C15H27F3N3+ — CID 156600041
4-decyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium (PubChem CID 156600041) has the molecular formula C15H27F3N3+ and a molecular weight of 306.40 g/mol. Its IUPAC name is 4-decyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-decyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600041 |
| Molecular Formula | C15H27F3N3+ |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 4-decyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
| SMILES | CCCCCCCCCC[n+]1cnn(CCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H27F3N3/c1-2-3-4-5-6-7-8-9-11-20-13-19-21(14-20)12-10-15(16,17)18/h13-14H,2-12H2,1H3/q+1 |
| InChIKey | PFLBTZDUXKLESB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|