C13H13F13N3+ — CID 156600045
1-propyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium (PubChem CID 156600045) has the molecular formula C13H13F13N3+ and a molecular weight of 458.24 g/mol. Its IUPAC name is 1-propyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium.
| Compound Name | 1-propyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600045 |
| Molecular Formula | C13H13F13N3+ |
| Molecular Weight | 458.24 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-propyl-4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,2,4-triazol-4-ium |
| SMILES | CCCn1c[n+](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H13F13N3/c1-2-4-29-7-28(6-27-29)5-3-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h6-7H,2-5H2,1H3/q+1 |
| InChIKey | QCNBSNPDMKXQNG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|