C12H15F9N3+ — CID 156600059
4-butyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium (PubChem CID 156600059) has the molecular formula C12H15F9N3+ and a molecular weight of 372.26 g/mol. Its IUPAC name is 4-butyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-butyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600059 |
| Molecular Formula | C12H15F9N3+ |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-butyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium |
| SMILES | CCCC[n+]1cnn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F9N3/c1-2-3-5-23-7-22-24(8-23)6-4-9(13,14)10(15,16)11(17,18)12(19,20)21/h7-8H,2-6H2,1H3/q+1 |
| InChIKey | SQCRQABCVIBMBQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|