C9H15F3N3+ — CID 156600088
4-butyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium (PubChem CID 156600088) has the molecular formula C9H15F3N3+ and a molecular weight of 222.23 g/mol. Its IUPAC name is 4-butyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-butyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156600088 |
| Molecular Formula | C9H15F3N3+ |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-butyl-1-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
| SMILES | CCCC[n+]1cnn(CCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H15F3N3/c1-2-3-5-14-7-13-15(8-14)6-4-9(10,11)12/h7-8H,2-6H2,1H3/q+1 |
| InChIKey | ZNPVLQJPDRNCLA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|