About 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide
3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide (PubChem CID 156600265) has the molecular formula C9H19BNO5-
and a molecular weight of 232.06 g/mol. Its IUPAC name is 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide.
Molecular Properties
| Compound Name | 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide |
| PubChem CID | 156600265 |
| Molecular Formula | C9H19BNO5- |
| Molecular Weight | 232.06 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide |
| SMILES | O=C(O)[C@H]1NCCC[C@H]1CCC[B-](O)(O)O |
| InChI | InChI=1S/C9H19BNO5/c12-9(13)8-7(4-2-6-11-8)3-1-5-10(14,15)16/h7-8,11,14-16H,1-6H2,(H,12,13)/q-1/t7-,8+/m1/s1 |
| InChIKey | WAXQJKOVLQGAHJ-SFYZADRCSA-N |
| XLogP | -0.86 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.06 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide?
The IUPAC name of 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide (CID 156600265) is 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide.
What is the SMILES notation for 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide?
The canonical SMILES for 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide is O=C(O)[C@H]1NCCC[C@H]1CCC[B-](O)(O)O.
What is the InChIKey of 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide?
The InChIKey is WAXQJKOVLQGAHJ-SFYZADRCSA-N. The full InChI is InChI=1S/C9H19BNO5/c12-9(13)8-7(4-2-6-11-8)3-1-5-10(14,15)16/h7-8,11,14-16H,1-6H2,(H,12,13)/q-1/t7-,8+/m1/s1.
What are the key properties of 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide?
3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide has a molecular weight of 232.06 g/mol, XLogP of -0.86, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,3R)-2-carboxypiperidin-3-yl]propyl-trihydroxyboranuide is sourced from PubChem (CID 156600265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).