C21H29N7O2 — CID 156600364
1-[1-(oxan-4-yl)ethyl]-4-oxo-6-(2-pyrimidin-2-ylcyclobutyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile (PubChem CID 156600364) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 1-[1-(oxan-4-yl)ethyl]-4-oxo-6-(2-pyrimidin-2-ylcyclobutyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile.
| Compound Name | 1-[1-(oxan-4-yl)ethyl]-4-oxo-6-(2-pyrimidin-2-ylcyclobutyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 156600364 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[1-(oxan-4-yl)ethyl]-4-oxo-6-(2-pyrimidin-2-ylcyclobutyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidine-3-carbonitrile |
| SMILES | CC(C1CCOCC1)N1NC(C#N)C2C(=O)NC(C3CCC3c3ncccn3)NC21 |
| InChI | InChI=1S/C21H29N7O2/c1-12(13-5-9-30-10-6-13)28-20-17(16(11-22)27-28)21(29)26-19(25-20)15-4-3-14(15)18-23-7-2-8-24-18/h2,7-8,12-17,19-20,25,27H,3-6,9-10H2,1H3,(H,26,29) |
| InChIKey | XISIHDBPJLPKJO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |