C28H33N5O3S — CID 156600698
N-[(1S,3R)-3-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600698) has the molecular formula C28H33N5O3S and a molecular weight of 519.67 g/mol. Its IUPAC name is N-[(1S,3R)-3-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1S,3R)-3-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600698 |
| Molecular Formula | C28H33N5O3S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | N-[(1S,3R)-3-aminocyclohexyl]-7-(2-methyl-4-phenoxyphenyl)-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | Cc1cc(Oc2ccccc2)ccc1N1C(=O)NC2=C(C(=O)N[C@H]3CCC[C@@H](N)C3)SC3NCCC1C23 |
| InChI | InChI=1S/C28H33N5O3S/c1-16-14-20(36-19-8-3-2-4-9-19)10-11-21(16)33-22-12-13-30-27-23(22)24(32-28(33)35)25(37-27)26(34)31-18-7-5-6-17(29)15-18/h2-4,8-11,14,17-18,22-23,27,30H,5-7,12-13,15,29H2,1H3,(H,31,34)(H,32,35)/t17-,18+,22?,23?,27?/m1/s1 |
| InChIKey | UREOUWBZTVGUCW-SVCYRWPYSA-N |
| XLogP | 3.97 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |