C25H28N6O2S — CID 156600731
N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenyl-2-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600731) has the molecular formula C25H28N6O2S and a molecular weight of 476.61 g/mol. Its IUPAC name is N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenyl-2-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenyl-2-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600731 |
| Molecular Formula | C25H28N6O2S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | N-[(1R,2S)-2-aminocyclopentyl]-6-oxo-7-(4-phenyl-2-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | N[C@H]1CCC[C@H]1NC(=O)C1=C2NC(=O)N(c3cc(-c4ccccc4)ccn3)C3CCNC(S1)C23 |
| InChI | InChI=1S/C25H28N6O2S/c26-16-7-4-8-17(16)29-23(32)22-21-20-18(10-12-28-24(20)34-22)31(25(33)30-21)19-13-15(9-11-27-19)14-5-2-1-3-6-14/h1-3,5-6,9,11,13,16-18,20,24,28H,4,7-8,10,12,26H2,(H,29,32)(H,30,33)/t16-,17+,18?,20?,24?/m0/s1 |
| InChIKey | GAYXOSGBOMRMGE-UIRFXXPVSA-N |
| XLogP | 2.54 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |