C26H35N7O3S — CID 156600786
7-[4-methyl-6-(propan-2-ylamino)-3-pyridinyl]-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide (PubChem CID 156600786) has the molecular formula C26H35N7O3S and a molecular weight of 525.68 g/mol. Its IUPAC name is 7-[4-methyl-6-(propan-2-ylamino)-3-pyridinyl]-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide.
| Compound Name | 7-[4-methyl-6-(propan-2-ylamino)-3-pyridinyl]-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
|---|---|
| PubChem CID | 156600786 |
| Molecular Formula | C26H35N7O3S |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 7-[4-methyl-6-(propan-2-ylamino)-3-pyridinyl]-6-oxo-N-[(1R,2S)-2-(prop-2-enoylamino)cyclopentyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodec-3-ene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCC[C@H]1NC(=O)C1=C2NC(=O)N(c3cnc(NC(C)C)cc3C)C3CCNC(S1)C23 |
| InChI | InChI=1S/C26H35N7O3S/c1-5-20(34)30-15-7-6-8-16(15)31-24(35)23-22-21-17(9-10-27-25(21)37-23)33(26(36)32-22)18-12-28-19(11-14(18)4)29-13(2)3/h5,11-13,15-17,21,25,27H,1,6-10H2,2-4H3,(H,28,29)(H,30,34)(H,31,35)(H,32,36)/t15-,16+,17?,21?,25?/m0/s1 |
| InChIKey | KVBQIZWBNAVMFD-LTXJDOALSA-N |
| XLogP | 2.34 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|