C13H24N6O6 — CID 156601175
N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(hydroxymethyl)formamide (PubChem CID 156601175) has the molecular formula C13H24N6O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(hydroxymethyl)formamide.
| Compound Name | N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(hydroxymethyl)formamide |
|---|---|
| PubChem CID | 156601175 |
| Molecular Formula | C13H24N6O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-[4,6-bis[bis(methoxymethyl)amino]-1,3,5-triazin-2-yl]-N-(hydroxymethyl)formamide |
| SMILES | COCN(COC)c1nc(N(C=O)CO)nc(N(COC)COC)n1 |
| InChI | InChI=1S/C13H24N6O6/c1-22-7-18(8-23-2)12-14-11(17(5-20)6-21)15-13(16-12)19(9-24-3)10-25-4/h5,21H,6-10H2,1-4H3 |
| InChIKey | PRDOSDUGXKTFET-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'melamine_B(1)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|