About 4-methylsulfanyl-2,6-diphenyl-4H-pyran
4-methylsulfanyl-2,6-diphenyl-4H-pyran (PubChem CID 156601254) has the molecular formula C18H16OS
and a molecular weight of 280.39 g/mol. Its IUPAC name is 4-methylsulfanyl-2,6-diphenyl-4H-pyran.
Molecular Properties
| Compound Name | 4-methylsulfanyl-2,6-diphenyl-4H-pyran |
| PubChem CID | 156601254 |
| Molecular Formula | C18H16OS |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-methylsulfanyl-2,6-diphenyl-4H-pyran |
| SMILES | CSC1C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C18H16OS/c1-20-16-12-17(14-8-4-2-5-9-14)19-18(13-16)15-10-6-3-7-11-15/h2-13,16H,1H3 |
| InChIKey | HRFIBMQZRHCUKY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylsulfanyl-2,6-diphenyl-4H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-2,6-diphenyl-4H-pyran?
The IUPAC name of 4-methylsulfanyl-2,6-diphenyl-4H-pyran (CID 156601254) is 4-methylsulfanyl-2,6-diphenyl-4H-pyran.
What is the SMILES notation for 4-methylsulfanyl-2,6-diphenyl-4H-pyran?
The canonical SMILES for 4-methylsulfanyl-2,6-diphenyl-4H-pyran is CSC1C=C(c2ccccc2)OC(c2ccccc2)=C1.
What is the InChIKey of 4-methylsulfanyl-2,6-diphenyl-4H-pyran?
The InChIKey is HRFIBMQZRHCUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16OS/c1-20-16-12-17(14-8-4-2-5-9-14)19-18(13-16)15-10-6-3-7-11-15/h2-13,16H,1H3.
What are the key properties of 4-methylsulfanyl-2,6-diphenyl-4H-pyran?
4-methylsulfanyl-2,6-diphenyl-4H-pyran has a molecular weight of 280.39 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-2,6-diphenyl-4H-pyran is sourced from PubChem (CID 156601254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).