C20H15N3O4S — CID 156601390
3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]benzoic acid (PubChem CID 156601390) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is 3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 156601390 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-[(2-phenyl-3H-benzimidazol-5-yl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NS(=O)(=O)c2ccc3nc(-c4ccccc4)[nH]c3c2)c1 |
| InChI | InChI=1S/C20H15N3O4S/c24-20(25)14-7-4-8-15(11-14)23-28(26,27)16-9-10-17-18(12-16)22-19(21-17)13-5-2-1-3-6-13/h1-12,23H,(H,21,22)(H,24,25) |
| InChIKey | VZZMPTKVIHPTAM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |