About N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide
N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide (PubChem CID 156601542) has the molecular formula C15H18N4O2
and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide |
| PubChem CID | 156601542 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCNCC1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H18N4O2/c1-10(20)17-13-7-8-16-9-12(13)15-18-14(19-21-15)11-5-3-2-4-6-11/h2-6,12-13,16H,7-9H2,1H3,(H,17,20) |
| InChIKey | SHPDOUMMEHSAGL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide?
The IUPAC name of N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide (CID 156601542) is N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide.
What is the SMILES notation for N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide?
The canonical SMILES for N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide is CC(=O)NC1CCNCC1c1nc(-c2ccccc2)no1.
What is the InChIKey of N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide?
The InChIKey is SHPDOUMMEHSAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-10(20)17-13-7-8-16-9-12(13)15-18-14(19-21-15)11-5-3-2-4-6-11/h2-6,12-13,16H,7-9H2,1H3,(H,17,20).
What are the key properties of N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide?
N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide has a molecular weight of 286.33 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]acetamide is sourced from PubChem (CID 156601542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).