C20H27FN2O2 — CID 156601722
N-[(1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]-2-(3-fluorophenyl)-N-methylacetamide (PubChem CID 156601722) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[(1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]-2-(3-fluorophenyl)-N-methylacetamide.
| Compound Name | N-[(1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]-2-(3-fluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 156601722 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-[(1-ethyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl)methyl]-2-(3-fluorophenyl)-N-methylacetamide |
| SMILES | CCN1C(=O)CCC2(CN(C)C(=O)Cc3cccc(F)c3)CCCC12 |
| InChI | InChI=1S/C20H27FN2O2/c1-3-23-17-8-5-10-20(17,11-9-18(23)24)14-22(2)19(25)13-15-6-4-7-16(21)12-15/h4,6-7,12,17H,3,5,8-11,13-14H2,1-2H3 |
| InChIKey | ROHSPTMIRVOWMW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |