C20H28N2O2 — CID 156602499
[(1R,2R,8S,9R,11R)-8-methyl-7-azatricyclo[7.2.1.02,7]dodecan-11-yl] N-(4-methylphenyl)carbamate (PubChem CID 156602499) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is [(1R,2R,8S,9R,11R)-8-methyl-7-azatricyclo[7.2.1.02,7]dodecan-11-yl] N-(4-methylphenyl)carbamate.
| Compound Name | [(1R,2R,8S,9R,11R)-8-methyl-7-azatricyclo[7.2.1.02,7]dodecan-11-yl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 156602499 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(1R,2R,8S,9R,11R)-8-methyl-7-azatricyclo[7.2.1.02,7]dodecan-11-yl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@@H]2C[C@H]3C[C@@H]2[C@H]2CCCCN2[C@H]3C)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-13-6-8-16(9-7-13)21-20(23)24-19-12-15-11-17(19)18-5-3-4-10-22(18)14(15)2/h6-9,14-15,17-19H,3-5,10-12H2,1-2H3,(H,21,23)/t14-,15+,17+,18+,19+/m0/s1 |
| InChIKey | WQYXCPUGQWEXMJ-ZPKKHLQPSA-N |
| XLogP | 4.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |