C19H23N5O3S — CID 156604128
(1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(4-methyl-2-pyridin-3-ylpyrimidin-5-yl)methanone (PubChem CID 156604128) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is (1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(4-methyl-2-pyridin-3-ylpyrimidin-5-yl)methanone.
| Compound Name | (1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(4-methyl-2-pyridin-3-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 156604128 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl)-(4-methyl-2-pyridin-3-ylpyrimidin-5-yl)methanone |
| SMILES | CCN1CCN(C(=O)c2cnc(-c3cccnc3)nc2C)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C19H23N5O3S/c1-3-23-7-8-24(17-12-28(26,27)11-16(17)23)19(25)15-10-21-18(22-13(15)2)14-5-4-6-20-9-14/h4-6,9-10,16-17H,3,7-8,11-12H2,1-2H3 |
| InChIKey | RKEAVWXYWGTVDV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |