C14H19N3O2 — CID 156604629
N-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 156604629) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156604629 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl)-2-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC2CCC3CCCC32)c(=O)[nH]1 |
| InChI | InChI=1S/C14H19N3O2/c1-8-15-7-11(13(18)16-8)14(19)17-12-6-5-9-3-2-4-10(9)12/h7,9-10,12H,2-6H2,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | NOTYDTSBTDCGHS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |