About 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine
2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine (PubChem CID 156604716) has the molecular formula C15H22F2N4O3S
and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine.
Molecular Properties
| Compound Name | 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine |
| PubChem CID | 156604716 |
| Molecular Formula | C15H22F2N4O3S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine |
| SMILES | CC(C)C1CN(C(=O)c2ncc(F)cc2F)CC1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C15H22F2N4O3S/c1-9(2)11-7-21(8-13(11)19-25(23,24)20(3)4)15(22)14-12(17)5-10(16)6-18-14/h5-6,9,11,13,19H,7-8H2,1-4H3 |
| InChIKey | CNQSIHLWNHBVKZ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine?
The IUPAC name of 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine (CID 156604716) is 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine.
What is the SMILES notation for 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine?
The canonical SMILES for 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine is CC(C)C1CN(C(=O)c2ncc(F)cc2F)CC1NS(=O)(=O)N(C)C.
What is the InChIKey of 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine?
The InChIKey is CNQSIHLWNHBVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N4O3S/c1-9(2)11-7-21(8-13(11)19-25(23,24)20(3)4)15(22)14-12(17)5-10(16)6-18-14/h5-6,9,11,13,19H,7-8H2,1-4H3.
What are the key properties of 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine?
2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine has a molecular weight of 376.43 g/mol, XLogP of 0.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylsulfamoylamino)-4-propan-2-ylpyrrolidine-1-carbonyl]-3,5-difluoropyridine is sourced from PubChem (CID 156604716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).