About 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol
4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol (PubChem CID 156605238) has the molecular formula C15H26N4O2
and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol |
| PubChem CID | 156605238 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol |
| SMILES | CNc1cc(C)nc(N2CCC(O)(COC)C(C)(C)C2)n1 |
| InChI | InChI=1S/C15H26N4O2/c1-11-8-12(16-4)18-13(17-11)19-7-6-15(20,10-21-5)14(2,3)9-19/h8,20H,6-7,9-10H2,1-5H3,(H,16,17,18) |
| InChIKey | OLXZQIWGRWUGAR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol?
The IUPAC name of 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol (CID 156605238) is 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol.
What is the SMILES notation for 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol?
The canonical SMILES for 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol is CNc1cc(C)nc(N2CCC(O)(COC)C(C)(C)C2)n1.
What is the InChIKey of 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol?
The InChIKey is OLXZQIWGRWUGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4O2/c1-11-8-12(16-4)18-13(17-11)19-7-6-15(20,10-21-5)14(2,3)9-19/h8,20H,6-7,9-10H2,1-5H3,(H,16,17,18).
What are the key properties of 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol?
4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol has a molecular weight of 294.40 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-3,3-dimethyl-1-[4-methyl-6-(methylamino)pyrimidin-2-yl]piperidin-4-ol is sourced from PubChem (CID 156605238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).