About N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide
N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 156605337) has the molecular formula C12H19F3N2O3S
and a molecular weight of 328.36 g/mol. Its IUPAC name is N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide |
| PubChem CID | 156605337 |
| Molecular Formula | C12H19F3N2O3S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CN(C(=O)CCC(F)(F)F)CC1C1CC1 |
| InChI | InChI=1S/C12H19F3N2O3S/c1-21(19,20)16-10-7-17(6-9(10)8-2-3-8)11(18)4-5-12(13,14)15/h8-10,16H,2-7H2,1H3 |
| InChIKey | KBTJKMXGJSIRDL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide?
The IUPAC name of N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide (CID 156605337) is N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide?
The canonical SMILES for N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide is CS(=O)(=O)NC1CN(C(=O)CCC(F)(F)F)CC1C1CC1.
What is the InChIKey of N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide?
The InChIKey is KBTJKMXGJSIRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3N2O3S/c1-21(19,20)16-10-7-17(6-9(10)8-2-3-8)11(18)4-5-12(13,14)15/h8-10,16H,2-7H2,1H3.
What are the key properties of N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide?
N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide has a molecular weight of 328.36 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-cyclopropyl-1-(4,4,4-trifluorobutanoyl)pyrrolidin-3-yl]methanesulfonamide is sourced from PubChem (CID 156605337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).