C19H31N5O3 — CID 156606450
N-ethyl-4-[3-(4-methylpyrazol-1-yl)propanoylamino]-1-(oxan-4-yl)pyrrolidine-2-carboxamide (PubChem CID 156606450) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-ethyl-4-[3-(4-methylpyrazol-1-yl)propanoylamino]-1-(oxan-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-ethyl-4-[3-(4-methylpyrazol-1-yl)propanoylamino]-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 156606450 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-ethyl-4-[3-(4-methylpyrazol-1-yl)propanoylamino]-1-(oxan-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)C1CC(NC(=O)CCn2cc(C)cn2)CN1C1CCOCC1 |
| InChI | InChI=1S/C19H31N5O3/c1-3-20-19(26)17-10-15(13-24(17)16-5-8-27-9-6-16)22-18(25)4-7-23-12-14(2)11-21-23/h11-12,15-17H,3-10,13H2,1-2H3,(H,20,26)(H,22,25) |
| InChIKey | JWTKRSOCWXLRAG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |