C15H25N5O — CID 156607349
[1-(2-aminopyrimidin-4-yl)-4-(piperidin-1-ylmethyl)pyrrolidin-3-yl]methanol (PubChem CID 156607349) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is [1-(2-aminopyrimidin-4-yl)-4-(piperidin-1-ylmethyl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(2-aminopyrimidin-4-yl)-4-(piperidin-1-ylmethyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 156607349 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | [1-(2-aminopyrimidin-4-yl)-4-(piperidin-1-ylmethyl)pyrrolidin-3-yl]methanol |
| SMILES | Nc1nccc(N2CC(CO)C(CN3CCCCC3)C2)n1 |
| InChI | InChI=1S/C15H25N5O/c16-15-17-5-4-14(18-15)20-9-12(13(10-20)11-21)8-19-6-2-1-3-7-19/h4-5,12-13,21H,1-3,6-11H2,(H2,16,17,18) |
| InChIKey | IUHNWPUFMAQPFB-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |