C21H30N2O4 — CID 156607511
(3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl)-(2-morpholin-4-ylphenyl)methanone (PubChem CID 156607511) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is (3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl)-(2-morpholin-4-ylphenyl)methanone.
| Compound Name | (3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl)-(2-morpholin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 156607511 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (3a,6-dimethoxy-3,4,5,6,7,7a-hexahydro-2H-indol-1-yl)-(2-morpholin-4-ylphenyl)methanone |
| SMILES | COC1CCC2(OC)CCN(C(=O)c3ccccc3N3CCOCC3)C2C1 |
| InChI | InChI=1S/C21H30N2O4/c1-25-16-7-8-21(26-2)9-10-23(19(21)15-16)20(24)17-5-3-4-6-18(17)22-11-13-27-14-12-22/h3-6,16,19H,7-15H2,1-2H3 |
| InChIKey | UYWWRIUCNNPGGV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |