C16H26N4O3 — CID 156607740
3-methyl-2-[[4-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 156607740) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-methyl-2-[[4-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[4-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 156607740 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-methyl-2-[[4-(2-pyrazol-1-ylethyl)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | CC(C)C(NC(=O)N1CCC(CCn2cccn2)CC1)C(=O)O |
| InChI | InChI=1S/C16H26N4O3/c1-12(2)14(15(21)22)18-16(23)19-9-4-13(5-10-19)6-11-20-8-3-7-17-20/h3,7-8,12-14H,4-6,9-11H2,1-2H3,(H,18,23)(H,21,22) |
| InChIKey | JTQAGJSZSUQZPT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |