C17H24FN3 — CID 156608575
1-[1-(2-fluorophenyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 156608575) has the molecular formula C17H24FN3 and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[1-(2-fluorophenyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | 1-[1-(2-fluorophenyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 156608575 |
| Molecular Formula | C17H24FN3 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-[1-(2-fluorophenyl)piperidin-4-yl]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | Fc1ccccc1N1CCC(N2CCC3CNCC32)CC1 |
| InChI | InChI=1S/C17H24FN3/c18-15-3-1-2-4-16(15)20-8-6-14(7-9-20)21-10-5-13-11-19-12-17(13)21/h1-4,13-14,17,19H,5-12H2 |
| InChIKey | PYTJYWHFHWTNSU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |