C13H17F3N2O3S — CID 156609794
4,4,4-trifluoro-N-[3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]butanamide (PubChem CID 156609794) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]butanamide.
| Compound Name | 4,4,4-trifluoro-N-[3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]butanamide |
|---|---|
| PubChem CID | 156609794 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4,4,4-trifluoro-N-[3-(1,3-thiazol-4-ylmethoxy)oxan-4-yl]butanamide |
| SMILES | O=C(CCC(F)(F)F)NC1CCOCC1OCc1cscn1 |
| InChI | InChI=1S/C13H17F3N2O3S/c14-13(15,16)3-1-12(19)18-10-2-4-20-6-11(10)21-5-9-7-22-8-17-9/h7-8,10-11H,1-6H2,(H,18,19) |
| InChIKey | SUBWSZIOYWVCQF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |