C21H22F2N2O3S — CID 156610393
4-fluoro-N-[8-(5-fluoro-2-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-yl]benzamide (PubChem CID 156610393) has the molecular formula C21H22F2N2O3S and a molecular weight of 420.48 g/mol. Its IUPAC name is 4-fluoro-N-[8-(5-fluoro-2-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-yl]benzamide.
| Compound Name | 4-fluoro-N-[8-(5-fluoro-2-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
|---|---|
| PubChem CID | 156610393 |
| Molecular Formula | C21H22F2N2O3S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-fluoro-N-[8-(5-fluoro-2-methylphenyl)sulfonyl-8-azabicyclo[3.2.1]octan-3-yl]benzamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1C2CCC1CC(NC(=O)c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C21H22F2N2O3S/c1-13-2-5-16(23)10-20(13)29(27,28)25-18-8-9-19(25)12-17(11-18)24-21(26)14-3-6-15(22)7-4-14/h2-7,10,17-19H,8-9,11-12H2,1H3,(H,24,26) |
| InChIKey | FNEGPBXWJCDVPH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |