C26H32N4O2 — CID 156610539
3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol (PubChem CID 156610539) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol.
| Compound Name | 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol |
|---|---|
| PubChem CID | 156610539 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-[(E)-2-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)ethenyl]phenol |
| SMILES | CN1CCCN=C1/C=C/c1cccc(O)c1.CN1CCCN=C1/C=C/c1cccc(O)c1 |
| InChI | InChI=1S/2C13H16N2O/c2*1-15-9-3-8-14-13(15)7-6-11-4-2-5-12(16)10-11/h2*2,4-7,10,16H,3,8-9H2,1H3/b2*7-6+ |
| InChIKey | RVCKGFCBEYKKFX-YIKKBJQVSA-N |
| XLogP | 4.28 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |