About sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride
sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride (PubChem CID 156610568) has the molecular formula C6H11NaO6
and a molecular weight of 202.14 g/mol. Its IUPAC name is sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride.
Molecular Properties
| Compound Name | sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride |
| PubChem CID | 156610568 |
| Molecular Formula | C6H11NaO6 |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride |
| SMILES | O=C1OC(C(O)CO)C(O)C1O.[H-].[Na+] |
| InChI | InChI=1S/C6H10O6.Na.H/c7-1-2(8)5-3(9)4(10)6(11)12-5;;/h2-5,7-10H,1H2;;/q;+1;-1 |
| InChIKey | RBANRJFSOLWTLF-UHFFFAOYSA-N |
| XLogP | -5.90 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | -5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride?
The IUPAC name of sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride (CID 156610568) is sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride.
What is the SMILES notation for sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride?
The canonical SMILES for sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride is O=C1OC(C(O)CO)C(O)C1O.[H-].[Na+].
What is the InChIKey of sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride?
The InChIKey is RBANRJFSOLWTLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O6.Na.H/c7-1-2(8)5-3(9)4(10)6(11)12-5;;/h2-5,7-10H,1H2;;/q;+1;-1.
What are the key properties of sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride?
sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride has a molecular weight of 202.14 g/mol, XLogP of -5.90, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-(1,2-dihydroxyethyl)-3,4-dihydroxyoxolan-2-one;hydride is sourced from PubChem (CID 156610568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).