C18H24N2O4 — CID 156610734
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 156610734) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 156610734 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | COC1CCCC2CN(C(=O)Nc3ccc4c(c3)OCCO4)CC21 |
| InChI | InChI=1S/C18H24N2O4/c1-22-15-4-2-3-12-10-20(11-14(12)15)18(21)19-13-5-6-16-17(9-13)24-8-7-23-16/h5-6,9,12,14-15H,2-4,7-8,10-11H2,1H3,(H,19,21) |
| InChIKey | XARFBAZLEQBZEJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |