C20H28N2O3 — CID 156611876
1-(2-phenylmethoxyacetyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one (PubChem CID 156611876) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-(2-phenylmethoxyacetyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one.
| Compound Name | 1-(2-phenylmethoxyacetyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
|---|---|
| PubChem CID | 156611876 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-(2-phenylmethoxyacetyl)-3,4,5,6,7,8a,9,10,11,11a-decahydro-2H-cyclopenta[b][1,5]diazecin-8-one |
| SMILES | O=C1NCCCCCN(C(=O)COCc2ccccc2)C2CCCC12 |
| InChI | InChI=1S/C20H28N2O3/c23-19(15-25-14-16-8-3-1-4-9-16)22-13-6-2-5-12-21-20(24)17-10-7-11-18(17)22/h1,3-4,8-9,17-18H,2,5-7,10-15H2,(H,21,24) |
| InChIKey | FCSQEGHJCMNFNL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |