About 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile
4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile (PubChem CID 156611954) has the molecular formula C21H27N3O2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile |
| PubChem CID | 156611954 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCCCCCNC(=O)C3CCCCC32)cc1 |
| InChI | InChI=1S/C21H27N3O2/c22-15-16-9-11-17(12-10-16)21(26)24-14-6-2-1-5-13-23-20(25)18-7-3-4-8-19(18)24/h9-12,18-19H,1-8,13-14H2,(H,23,25) |
| InChIKey | JTLGDJBYQHZCBC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile?
The IUPAC name of 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile (CID 156611954) is 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile.
What is the SMILES notation for 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile?
The canonical SMILES for 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile is N#Cc1ccc(C(=O)N2CCCCCCNC(=O)C3CCCCC32)cc1.
What is the InChIKey of 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile?
The InChIKey is JTLGDJBYQHZCBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O2/c22-15-16-9-11-17(12-10-16)21(26)24-14-6-2-1-5-13-23-20(25)18-7-3-4-8-19(18)24/h9-12,18-19H,1-8,13-14H2,(H,23,25).
What are the key properties of 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile?
4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile has a molecular weight of 353.47 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(10-oxo-2,9-diazabicyclo[9.4.0]pentadecane-2-carbonyl)benzonitrile is sourced from PubChem (CID 156611954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).