About 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine
5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine (PubChem CID 156612396) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 156612396 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine |
| SMILES | COc1ccccc1-c1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C14H12N2O/c1-17-14-5-3-2-4-11(14)12-8-10-6-7-15-13(10)9-16-12/h2-9,15H,1H3 |
| InChIKey | OQLMNABKDGSWQO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine (CID 156612396) is 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine is COc1ccccc1-c1cc2cc[nH]c2cn1.
What is the InChIKey of 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is OQLMNABKDGSWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c1-17-14-5-3-2-4-11(14)12-8-10-6-7-15-13(10)9-16-12/h2-9,15H,1H3.
What are the key properties of 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine?
5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 224.26 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyphenyl)-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 156612396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).