C7H12O7 — CID 156612513
trans-(3R,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid (PubChem CID 156612513) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is trans-(3R,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 156612513 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | trans-(3R,5R)-1,2,3,4,5-pentahydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1(O)C[C@@H](O)C(O)[C@@H](O)C1O |
| InChI | InChI=1S/C7H12O7/c8-2-1-7(14,6(12)13)5(11)4(10)3(2)9/h2-5,8-11,14H,1H2,(H,12,13)/t2-,3?,4-,5?,7?/m1/s1 |
| InChIKey | OLBQNCISLUABGO-UUFYDXMUSA-N |
| XLogP | -3.35 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |