C31H23N3O2 — CID 156613324
5-[[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]methyl]quinolin-8-ol (PubChem CID 156613324) has the molecular formula C31H23N3O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is 5-[[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]methyl]quinolin-8-ol.
| Compound Name | 5-[[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 156613324 |
| Molecular Formula | C31H23N3O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 5-[[2-(4-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]methyl]quinolin-8-ol |
| SMILES | Oc1ccc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2Cc2ccc(O)c3ncccc23)cc1 |
| InChI | InChI=1S/C31H23N3O2/c35-25-16-13-23(14-17-25)31-33-28(21-8-3-1-4-9-21)30(22-10-5-2-6-11-22)34(31)20-24-15-18-27(36)29-26(24)12-7-19-32-29/h1-19,35-36H,20H2 |
| InChIKey | OPNNJGGAIJTBCY-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |