About trichloro(phenyl)silane;dihydrochloride
trichloro(phenyl)silane;dihydrochloride (PubChem CID 156614055) has the molecular formula C6H7Cl5Si
and a molecular weight of 284.47 g/mol. Its IUPAC name is trichloro(phenyl)silane;dihydrochloride.
Molecular Properties
| Compound Name | trichloro(phenyl)silane;dihydrochloride |
| PubChem CID | 156614055 |
| Molecular Formula | C6H7Cl5Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 281.88 |
| IUPAC Name | trichloro(phenyl)silane;dihydrochloride |
| SMILES | Cl.Cl.Cl[Si](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C6H5Cl3Si.2ClH/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H;2*1H |
| InChIKey | QFLNHKMRCRBGOY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro(phenyl)silane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro(phenyl)silane;dihydrochloride?
The IUPAC name of trichloro(phenyl)silane;dihydrochloride (CID 156614055) is trichloro(phenyl)silane;dihydrochloride.
What is the SMILES notation for trichloro(phenyl)silane;dihydrochloride?
The canonical SMILES for trichloro(phenyl)silane;dihydrochloride is Cl.Cl.Cl[Si](Cl)(Cl)c1ccccc1.
What is the InChIKey of trichloro(phenyl)silane;dihydrochloride?
The InChIKey is QFLNHKMRCRBGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3Si.2ClH/c7-10(8,9)6-4-2-1-3-5-6;;/h1-5H;2*1H.
What are the key properties of trichloro(phenyl)silane;dihydrochloride?
trichloro(phenyl)silane;dihydrochloride has a molecular weight of 284.47 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro(phenyl)silane;dihydrochloride is sourced from PubChem (CID 156614055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).