C20H30O15 — CID 156614214
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 156614214) has the molecular formula C20H30O15 and a molecular weight of 510.45 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 156614214 |
| Molecular Formula | C20H30O15 |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H30O15/c1-8(23)29-6-13-15(30-9(2)24)16(31-10(3)25)17(32-11(4)26)19(33-13)35-20(7-22)18(28)14(27)12(5-21)34-20/h12-19,21-22,27-28H,5-7H2,1-4H3/t12-,13-,14-,15-,16+,17-,18+,19?,20?/m1/s1 |
| InChIKey | CBQHXRWUFMGQIJ-HYTSUOBNSA-N |
| XLogP | -3.11 |
| TPSA | 213.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|