C28H46O3Si — CID 15661772
[(1E,3E)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]trideca-1,3-dien-5-yl] acetate (PubChem CID 15661772) has the molecular formula C28H46O3Si and a molecular weight of 458.76 g/mol. Its IUPAC name is [(1E,3E)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]trideca-1,3-dien-5-yl] acetate.
| Compound Name | [(1E,3E)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]trideca-1,3-dien-5-yl] acetate |
|---|---|
| PubChem CID | 15661772 |
| Molecular Formula | C28H46O3Si |
| Molecular Weight | 458.76 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | [(1E,3E)-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]trideca-1,3-dien-5-yl] acetate |
| SMILES | CCCCCCCCC(/C=C/C=C/c1cccc(CO[Si](C)(C)C(C)(C)C)c1)OC(C)=O |
| InChI | InChI=1S/C28H46O3Si/c1-8-9-10-11-12-13-20-27(31-24(2)29)21-15-14-17-25-18-16-19-26(22-25)23-30-32(6,7)28(3,4)5/h14-19,21-22,27H,8-13,20,23H2,1-7H3/b17-14+,21-15+ |
| InChIKey | RDODNBYNEGQJLC-LBNBPBRMSA-N |
| XLogP | 8.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.76 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|