C20H40S — CID 15661841
(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-thiol (PubChem CID 15661841) has the molecular formula C20H40S and a molecular weight of 312.61 g/mol. Its IUPAC name is (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-thiol.
| Compound Name | (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-thiol |
|---|---|
| PubChem CID | 15661841 |
| Molecular Formula | C20H40S |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | (E,7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-thiol |
| SMILES | C/C(=C\CS)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C20H40S/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1 |
| InChIKey | WGQGCMYAJSUBQW-PYDDKJGSSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|