C25H25N3O5 — CID 156620754
1-[2-[(2,6-dimethylphenoxy)methyl]benzimidazol-1-yl]-3-(4-nitrophenoxy)propan-2-ol (PubChem CID 156620754) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 1-[2-[(2,6-dimethylphenoxy)methyl]benzimidazol-1-yl]-3-(4-nitrophenoxy)propan-2-ol.
| Compound Name | 1-[2-[(2,6-dimethylphenoxy)methyl]benzimidazol-1-yl]-3-(4-nitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 156620754 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-[2-[(2,6-dimethylphenoxy)methyl]benzimidazol-1-yl]-3-(4-nitrophenoxy)propan-2-ol |
| SMILES | Cc1cccc(C)c1OCc1nc2ccccc2n1CC(O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-17-6-5-7-18(2)25(17)33-16-24-26-22-8-3-4-9-23(22)27(24)14-20(29)15-32-21-12-10-19(11-13-21)28(30)31/h3-13,20,29H,14-16H2,1-2H3 |
| InChIKey | LGAROORQULGVRE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|