2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid

C9H5NO5 — CID 156621276

IUPAC2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid
SMILESO=C1N=C2C=CC(C(=O)O)=CC2C(=O)O1
InChIInChI=1S/C9H5NO5/c11-7(12)4-1-2-6-5(3-4)8(13)15-9(14)10-6/h1-3,5H,(H,11,12)
InChIKeyAHPCKUQFHCVNDO-UHFFFAOYSA-N
MW207.14 g/mol
LogP0.30
Rot. Bonds1

About 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid

2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid (PubChem CID 156621276) has the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. Its IUPAC name is 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid.

Molecular Properties

Compound Name2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid
PubChem CID156621276
Molecular FormulaC9H5NO5
Molecular Weight207.14 g/mol
Exact Mass207.02
IUPAC Name2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid
SMILESO=C1N=C2C=CC(C(=O)O)=CC2C(=O)O1
InChIInChI=1S/C9H5NO5/c11-7(12)4-1-2-6-5(3-4)8(13)15-9(14)10-6/h1-3,5H,(H,11,12)
InChIKeyAHPCKUQFHCVNDO-UHFFFAOYSA-N
XLogP0.30
TPSA93.03 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.14
LogP ≤ 50.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid?
The IUPAC name of 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid (CID 156621276) is 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid.
What is the SMILES notation for 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid?
The canonical SMILES for 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid is O=C1N=C2C=CC(C(=O)O)=CC2C(=O)O1.
What is the InChIKey of 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid?
The InChIKey is AHPCKUQFHCVNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO5/c11-7(12)4-1-2-6-5(3-4)8(13)15-9(14)10-6/h1-3,5H,(H,11,12).
What are the key properties of 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid?
2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid has a molecular weight of 207.14 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-4aH-3,1-benzoxazine-6-carboxylic acid is sourced from PubChem (CID 156621276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).