C19H30O2 — CID 156621378
1-ethenyl-4-(2-octoxyethoxymethyl)benzene (PubChem CID 156621378) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 1-ethenyl-4-(2-octoxyethoxymethyl)benzene.
| Compound Name | 1-ethenyl-4-(2-octoxyethoxymethyl)benzene |
|---|---|
| PubChem CID | 156621378 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-ethenyl-4-(2-octoxyethoxymethyl)benzene |
| SMILES | C=Cc1ccc(COCCOCCCCCCCC)cc1 |
| InChI | InChI=1S/C19H30O2/c1-3-5-6-7-8-9-14-20-15-16-21-17-19-12-10-18(4-2)11-13-19/h4,10-13H,2-3,5-9,14-17H2,1H3 |
| InChIKey | MDFJUJIKWQQGFZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|