C18H40NO9+ — CID 156621797
bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-[2-(3-hydroxypropoxymethoxy)ethyl]azanium (PubChem CID 156621797) has the molecular formula C18H40NO9+ and a molecular weight of 414.52 g/mol. Its IUPAC name is bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-[2-(3-hydroxypropoxymethoxy)ethyl]azanium.
| Compound Name | bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-[2-(3-hydroxypropoxymethoxy)ethyl]azanium |
|---|---|
| PubChem CID | 156621797 |
| Molecular Formula | C18H40NO9+ |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-[2-(3-hydroxypropoxymethoxy)ethyl]azanium |
| SMILES | OCCCOCOCC[NH+](CCOCCOCCO)CCOCCOCCO |
| InChI | InChI=1S/C18H39NO9/c20-5-1-8-27-18-28-11-4-19(2-9-23-14-16-25-12-6-21)3-10-24-15-17-26-13-7-22/h20-22H,1-18H2/p+1 |
| InChIKey | IXPMQILHMGSUPD-UHFFFAOYSA-O |
| XLogP | -2.70 |
| TPSA | 120.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|