C26H35NO12 — CID 156622361
2-methoxyethyl 2-[2-[2-[2-(2-acetyloxypropanoyloxy)propanoyloxy]propanoyloxy]propanoylamino]-3-phenylpropanoate (PubChem CID 156622361) has the molecular formula C26H35NO12 and a molecular weight of 553.56 g/mol. Its IUPAC name is 2-methoxyethyl 2-[2-[2-[2-(2-acetyloxypropanoyloxy)propanoyloxy]propanoyloxy]propanoylamino]-3-phenylpropanoate.
| Compound Name | 2-methoxyethyl 2-[2-[2-[2-(2-acetyloxypropanoyloxy)propanoyloxy]propanoyloxy]propanoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 156622361 |
| Molecular Formula | C26H35NO12 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | 2-methoxyethyl 2-[2-[2-[2-(2-acetyloxypropanoyloxy)propanoyloxy]propanoyloxy]propanoylamino]-3-phenylpropanoate |
| SMILES | COCCOC(=O)C(Cc1ccccc1)NC(=O)C(C)OC(=O)C(C)OC(=O)C(C)OC(=O)C(C)OC(C)=O |
| InChI | InChI=1S/C26H35NO12/c1-15(22(29)27-21(26(33)35-13-12-34-6)14-20-10-8-7-9-11-20)37-24(31)17(3)39-25(32)18(4)38-23(30)16(2)36-19(5)28/h7-11,15-18,21H,12-14H2,1-6H3,(H,27,29) |
| InChIKey | RCVVDIVZCPFTHQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|