C41H33BN4O2 — CID 156622911
CID 156622911 (PubChem CID 156622911) has the molecular formula C41H33BN4O2 and a molecular weight of 624.55 g/mol.
| Compound Name | CID 156622911 |
|---|---|
| PubChem CID | 156622911 |
| Molecular Formula | C41H33BN4O2 |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1B1Oc2cccnc2N1c1cccc(Oc2ccc3c(c2)-n2[c-][n+](-c4ccccc4)c4cccc(c42)C3(C)C)c1 |
| InChI | InChI=1S/C41H33BN4O2/c1-27-12-8-13-28(2)38(27)42-46(40-37(48-42)20-11-23-43-40)30-16-9-17-31(24-30)47-32-21-22-33-36(25-32)45-26-44(29-14-6-5-7-15-29)35-19-10-18-34(39(35)45)41(33,3)4/h5-25H,1-4H3 |
| InChIKey | MZLBEUOPRSYSGK-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|